C13H21ClN4O — CID 80504285
[2-(aminomethyl)-4-methylpiperazin-1-yl]-(4-chloro-1-ethylpyrrol-2-yl)methanone (PubChem CID 80504285) has the molecular formula C13H21ClN4O and a molecular weight of 284.79 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperazin-1-yl]-(4-chloro-1-ethylpyrrol-2-yl)methanone.
| Compound Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(4-chloro-1-ethylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 80504285 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(4-chloro-1-ethylpyrrol-2-yl)methanone |
| SMILES | CCn1cc(Cl)cc1C(=O)N1CCN(C)CC1CN |
| InChI | InChI=1S/C13H21ClN4O/c1-3-17-8-10(14)6-12(17)13(19)18-5-4-16(2)9-11(18)7-15/h6,8,11H,3-5,7,9,15H2,1-2H3 |
| InChIKey | DGBMTURCGITZML-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 54.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |