C17H20N2O3S — CID 154773094
methyl 2-[(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-benzothiazole-6-carboxylate (PubChem CID 154773094) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl 2-[(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 154773094 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 2-[(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N3C[C@H]4C[C@@H](O)CC[C@H]4C3)sc2c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-22-16(21)10-3-5-14-15(7-10)23-17(18-14)19-8-11-2-4-13(20)6-12(11)9-19/h3,5,7,11-13,20H,2,4,6,8-9H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | IXLURDAGEGCCCC-XQQFMLRXSA-N |
| XLogP | 2.68 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |