C10H9BrN2OS — CID 66906067
1-(6-bromo-1,3-benzothiazol-2-yl)azetidin-3-ol (PubChem CID 66906067) has the molecular formula C10H9BrN2OS and a molecular weight of 285.17 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzothiazol-2-yl)azetidin-3-ol.
| Compound Name | 1-(6-bromo-1,3-benzothiazol-2-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 66906067 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 1-(6-bromo-1,3-benzothiazol-2-yl)azetidin-3-ol |
| SMILES | OC1CN(c2nc3ccc(Br)cc3s2)C1 |
| InChI | InChI=1S/C10H9BrN2OS/c11-6-1-2-8-9(3-6)15-10(12-8)13-4-7(14)5-13/h1-3,7,14H,4-5H2 |
| InChIKey | NCCLVBAIQKYMAT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |