C17H22BrN3S — CID 66905916
6-bromo-2-[(3S)-3-piperidin-1-ylpiperidin-1-yl]-1,3-benzothiazole (PubChem CID 66905916) has the molecular formula C17H22BrN3S and a molecular weight of 380.36 g/mol. Its IUPAC name is 6-bromo-2-[(3S)-3-piperidin-1-ylpiperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-bromo-2-[(3S)-3-piperidin-1-ylpiperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66905916 |
| Molecular Formula | C17H22BrN3S |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 6-bromo-2-[(3S)-3-piperidin-1-ylpiperidin-1-yl]-1,3-benzothiazole |
| SMILES | Brc1ccc2nc(N3CCC[C@H](N4CCCCC4)C3)sc2c1 |
| InChI | InChI=1S/C17H22BrN3S/c18-13-6-7-15-16(11-13)22-17(19-15)21-10-4-5-14(12-21)20-8-2-1-3-9-20/h6-7,11,14H,1-5,8-10,12H2/t14-/m0/s1 |
| InChIKey | KIIFOCGCRUYTFQ-AWEZNQCLSA-N |
| XLogP | 4.51 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |