C21H18N2O3 — CID 154774789
N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-phenylfuran-2-carboxamide (PubChem CID 154774789) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-phenylfuran-2-carboxamide.
| Compound Name | N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 154774789 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-phenylfuran-2-carboxamide |
| SMILES | CC(NC(=O)c1occc1-c1ccccc1)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C21H18N2O3/c1-13(15-7-8-18-16(11-15)12-19(24)23-18)22-21(25)20-17(9-10-26-20)14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | ZSMLSZZVDOHWBY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |