C26H21N3O2 — CID 166179805
N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 166179805) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 166179805 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccccc2)nc2ccccc12)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C26H21N3O2/c1-16(18-11-12-22-19(13-18)14-25(30)29-22)27-26(31)21-15-24(17-7-3-2-4-8-17)28-23-10-6-5-9-20(21)23/h2-13,15-16H,14H2,1H3,(H,27,31)(H,29,30) |
| InChIKey | DQCIECSVGZDMIQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |