C25H20N2O3 — CID 6604858
methyl (2R)-2-phenyl-2-[(2-phenylquinoline-4-carbonyl)amino]acetate (PubChem CID 6604858) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is methyl (2R)-2-phenyl-2-[(2-phenylquinoline-4-carbonyl)amino]acetate.
| Compound Name | methyl (2R)-2-phenyl-2-[(2-phenylquinoline-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 6604858 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl (2R)-2-phenyl-2-[(2-phenylquinoline-4-carbonyl)amino]acetate |
| SMILES | COC(=O)[C@H](NC(=O)c1cc(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O3/c1-30-25(29)23(18-12-6-3-7-13-18)27-24(28)20-16-22(17-10-4-2-5-11-17)26-21-15-9-8-14-19(20)21/h2-16,23H,1H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | IUMQXQJZIHWLIN-HSZRJFAPSA-N |
| XLogP | 4.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |