C28H22N2O2 — CID 71170471
N-[(5-methylfuran-2-yl)-phenylmethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 71170471) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)-phenylmethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(5-methylfuran-2-yl)-phenylmethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 71170471 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[(5-methylfuran-2-yl)-phenylmethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c2ccccc2)o1 |
| InChI | InChI=1S/C28H22N2O2/c1-19-16-17-26(32-19)27(21-12-6-3-7-13-21)30-28(31)23-18-25(20-10-4-2-5-11-20)29-24-15-9-8-14-22(23)24/h2-18,27H,1H3,(H,30,31) |
| InChIKey | FRSJIKIEYSIMDQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |