C31H26N4O2 — CID 67208958
N-[2-[(2-aminophenyl)methylamino]-2-oxo-1-phenylethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 67208958) has the molecular formula C31H26N4O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[2-[(2-aminophenyl)methylamino]-2-oxo-1-phenylethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[2-[(2-aminophenyl)methylamino]-2-oxo-1-phenylethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 67208958 |
| Molecular Formula | C31H26N4O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[2-[(2-aminophenyl)methylamino]-2-oxo-1-phenylethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | Nc1ccccc1CNC(=O)C(NC(=O)c1cc(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C31H26N4O2/c32-26-17-9-7-15-23(26)20-33-31(37)29(22-13-5-2-6-14-22)35-30(36)25-19-28(21-11-3-1-4-12-21)34-27-18-10-8-16-24(25)27/h1-19,29H,20,32H2,(H,33,37)(H,35,36) |
| InChIKey | PGBDHQSNNZBFNT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|