C32H23N3O3 — CID 10577234
N-[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-phenylethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 10577234) has the molecular formula C32H23N3O3 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-phenylethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-phenylethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 10577234 |
| Molecular Formula | C32H23N3O3 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[(1R)-2-(1,3-dioxoisoindol-2-yl)-1-phenylethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N[C@@H](CN1C(=O)c2ccccc2C1=O)c1ccccc1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C32H23N3O3/c36-30(26-19-28(21-11-3-1-4-12-21)33-27-18-10-9-15-23(26)27)34-29(22-13-5-2-6-14-22)20-35-31(37)24-16-7-8-17-25(24)32(35)38/h1-19,29H,20H2,(H,34,36)/t29-/m0/s1 |
| InChIKey | UYNHWIGXVYXEAP-LJAQVGFWSA-N |
| XLogP | 5.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|