C15H15NO6S2 — CID 154775001
methyl 2-[3-[(5-methylthiophen-2-yl)sulfonylcarbamoyl]phenoxy]acetate (PubChem CID 154775001) has the molecular formula C15H15NO6S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 2-[3-[(5-methylthiophen-2-yl)sulfonylcarbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(5-methylthiophen-2-yl)sulfonylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 154775001 |
| Molecular Formula | C15H15NO6S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | methyl 2-[3-[(5-methylthiophen-2-yl)sulfonylcarbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(C(=O)NS(=O)(=O)c2ccc(C)s2)c1 |
| InChI | InChI=1S/C15H15NO6S2/c1-10-6-7-14(23-10)24(19,20)16-15(18)11-4-3-5-12(8-11)22-9-13(17)21-2/h3-8H,9H2,1-2H3,(H,16,18) |
| InChIKey | SACIDZCMAIDCLQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |