C19H20N2O6S — CID 55871864
methyl 2-[3-[[3-(cyclopropylsulfamoyl)phenyl]carbamoyl]phenoxy]acetate (PubChem CID 55871864) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is methyl 2-[3-[[3-(cyclopropylsulfamoyl)phenyl]carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[3-(cyclopropylsulfamoyl)phenyl]carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55871864 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl 2-[3-[[3-(cyclopropylsulfamoyl)phenyl]carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(C(=O)Nc2cccc(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C19H20N2O6S/c1-26-18(22)12-27-16-6-2-4-13(10-16)19(23)20-15-5-3-7-17(11-15)28(24,25)21-14-8-9-14/h2-7,10-11,14,21H,8-9,12H2,1H3,(H,20,23) |
| InChIKey | KWXKJCHPFUWYCW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |