C17H25N5 — CID 154778874
4-tert-butyl-6-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]pyrimidine (PubChem CID 154778874) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-tert-butyl-6-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]pyrimidine.
| Compound Name | 4-tert-butyl-6-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 154778874 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 4-tert-butyl-6-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]pyrimidine |
| SMILES | Cc1cnn(C2CCCN(c3cc(C(C)(C)C)ncn3)C2)c1 |
| InChI | InChI=1S/C17H25N5/c1-13-9-20-22(10-13)14-6-5-7-21(11-14)16-8-15(17(2,3)4)18-12-19-16/h8-10,12,14H,5-7,11H2,1-4H3 |
| InChIKey | TXMZBJQDWQMMFF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |