C14H20F2N2O2 — CID 154783141
N-[2-(2,2-difluoroethoxy)phenyl]-1-methoxypiperidin-4-amine (PubChem CID 154783141) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)phenyl]-1-methoxypiperidin-4-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)phenyl]-1-methoxypiperidin-4-amine |
|---|---|
| PubChem CID | 154783141 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)phenyl]-1-methoxypiperidin-4-amine |
| SMILES | CON1CCC(Nc2ccccc2OCC(F)F)CC1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-19-18-8-6-11(7-9-18)17-12-4-2-3-5-13(12)20-10-14(15)16/h2-5,11,14,17H,6-10H2,1H3 |
| InChIKey | RMKMIDSJFXOZLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |