C15H21F3N2O — CID 65070364
1-methyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]azepan-4-amine (PubChem CID 65070364) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-methyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]azepan-4-amine.
| Compound Name | 1-methyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]azepan-4-amine |
|---|---|
| PubChem CID | 65070364 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-methyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]azepan-4-amine |
| SMILES | CN1CCCC(Nc2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N2O/c1-20-9-4-5-12(8-10-20)19-13-6-2-3-7-14(13)21-11-15(16,17)18/h2-3,6-7,12,19H,4-5,8-11H2,1H3 |
| InChIKey | FNGRSVMIXYDSNC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |