C16H22F3NO — CID 64734525
N-(3,4-dimethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 64734525) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 64734525 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CC1CCC(Nc2ccccc2OCC(F)(F)F)CC1C |
| InChI | InChI=1S/C16H22F3NO/c1-11-7-8-13(9-12(11)2)20-14-5-3-4-6-15(14)21-10-16(17,18)19/h3-6,11-13,20H,7-10H2,1-2H3 |
| InChIKey | KSKSDWMUPZOIPU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |