C14H18F2N4O4 — CID 154783340
ethyl 2-[4-[2,2-difluoro-2-(1-methylimidazol-2-yl)acetyl]piperazin-1-yl]-2-oxoacetate (PubChem CID 154783340) has the molecular formula C14H18F2N4O4 and a molecular weight of 344.32 g/mol. Its IUPAC name is ethyl 2-[4-[2,2-difluoro-2-(1-methylimidazol-2-yl)acetyl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[2,2-difluoro-2-(1-methylimidazol-2-yl)acetyl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 154783340 |
| Molecular Formula | C14H18F2N4O4 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethyl 2-[4-[2,2-difluoro-2-(1-methylimidazol-2-yl)acetyl]piperazin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCN(C(=O)C(F)(F)c2nccn2C)CC1 |
| InChI | InChI=1S/C14H18F2N4O4/c1-3-24-11(22)10(21)19-6-8-20(9-7-19)13(23)14(15,16)12-17-4-5-18(12)2/h4-5H,3,6-9H2,1-2H3 |
| InChIKey | CVKGBGZRJSCPGX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|