C19H29N5 — CID 154785628
2-methyl-2-[1-[(1-methyl-3-pyridin-3-ylpyrazol-4-yl)methyl]piperidin-4-yl]propan-1-amine (PubChem CID 154785628) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 2-methyl-2-[1-[(1-methyl-3-pyridin-3-ylpyrazol-4-yl)methyl]piperidin-4-yl]propan-1-amine.
| Compound Name | 2-methyl-2-[1-[(1-methyl-3-pyridin-3-ylpyrazol-4-yl)methyl]piperidin-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 154785628 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 2-methyl-2-[1-[(1-methyl-3-pyridin-3-ylpyrazol-4-yl)methyl]piperidin-4-yl]propan-1-amine |
| SMILES | Cn1cc(CN2CCC(C(C)(C)CN)CC2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H29N5/c1-19(2,14-20)17-6-9-24(10-7-17)13-16-12-23(3)22-18(16)15-5-4-8-21-11-15/h4-5,8,11-12,17H,6-7,9-10,13-14,20H2,1-3H3 |
| InChIKey | QEILRYRLDSGHRU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |