C13H14N6O3 — CID 154787253
4-methyl-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3,5-dioxopiperazine-1-carboxamide (PubChem CID 154787253) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-methyl-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3,5-dioxopiperazine-1-carboxamide.
| Compound Name | 4-methyl-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3,5-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 154787253 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-methyl-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3,5-dioxopiperazine-1-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)N3CC(=O)N(C)C(=O)C3)cn2n1 |
| InChI | InChI=1S/C13H14N6O3/c1-8-14-10-4-3-9(5-19(10)16-8)15-13(22)18-6-11(20)17(2)12(21)7-18/h3-5H,6-7H2,1-2H3,(H,15,22) |
| InChIKey | LSSRFYHMVNONEM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|