C16H25N7O2 — CID 154787652
1-[2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)urea (PubChem CID 154787652) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)urea.
| Compound Name | 1-[2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)urea |
|---|---|
| PubChem CID | 154787652 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)urea |
| SMILES | COCCn1cc2c(n1)C(NC(=O)Nc1n[nH]c(C(C)C)n1)CCC2 |
| InChI | InChI=1S/C16H25N7O2/c1-10(2)14-18-15(21-20-14)19-16(24)17-12-6-4-5-11-9-23(7-8-25-3)22-13(11)12/h9-10,12H,4-8H2,1-3H3,(H3,17,18,19,20,21,24) |
| InChIKey | KMBDPADDXHPYHU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |