C13H17N5O3S — CID 124873796
N-[(7S)-2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 124873796) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[(7S)-2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[(7S)-2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124873796 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[(7S)-2-(2-methoxyethyl)-4,5,6,7-tetrahydroindazol-7-yl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | COCCn1cc2c(n1)[C@@H](Nc1ncc([N+](=O)[O-])s1)CCC2 |
| InChI | InChI=1S/C13H17N5O3S/c1-21-6-5-17-8-9-3-2-4-10(12(9)16-17)15-13-14-7-11(22-13)18(19)20/h7-8,10H,2-6H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | MWXLDVDGMJNVQA-JTQLQIEISA-N |
| XLogP | 2.38 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|