C17H24N4O2 — CID 154788533
N-(1-anilinobutan-2-yl)-2-[(1-methylimidazol-2-yl)methoxy]acetamide (PubChem CID 154788533) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(1-anilinobutan-2-yl)-2-[(1-methylimidazol-2-yl)methoxy]acetamide.
| Compound Name | N-(1-anilinobutan-2-yl)-2-[(1-methylimidazol-2-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 154788533 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(1-anilinobutan-2-yl)-2-[(1-methylimidazol-2-yl)methoxy]acetamide |
| SMILES | CCC(CNc1ccccc1)NC(=O)COCc1nccn1C |
| InChI | InChI=1S/C17H24N4O2/c1-3-14(11-19-15-7-5-4-6-8-15)20-17(22)13-23-12-16-18-9-10-21(16)2/h4-10,14,19H,3,11-13H2,1-2H3,(H,20,22) |
| InChIKey | MLNGPYXGJJEMNX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |