C15H20O8S — CID 15478863
[(2R,3S,4R,5S)-2-(1,3-dioxolan-2-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 15478863) has the molecular formula C15H20O8S and a molecular weight of 360.38 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2-(1,3-dioxolan-2-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5S)-2-(1,3-dioxolan-2-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15478863 |
| Molecular Formula | C15H20O8S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [(2R,3S,4R,5S)-2-(1,3-dioxolan-2-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H](O)[C@H](CO)O[C@H]2C2OCCO2)cc1 |
| InChI | InChI=1S/C15H20O8S/c1-9-2-4-10(5-3-9)24(18,19)23-13-12(17)11(8-16)22-14(13)15-20-6-7-21-15/h2-5,11-17H,6-8H2,1H3/t11-,12+,13-,14+/m0/s1 |
| InChIKey | QSUHUOSCCJMGLT-RFQIPJPRSA-N |
| XLogP | -0.44 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|