C11H10ClF6N — CID 154791421
3-[2,6-bis(trifluoromethyl)phenyl]azetidine;hydrochloride (PubChem CID 154791421) has the molecular formula C11H10ClF6N and a molecular weight of 305.65 g/mol. Its IUPAC name is 3-[2,6-bis(trifluoromethyl)phenyl]azetidine;hydrochloride.
| Compound Name | 3-[2,6-bis(trifluoromethyl)phenyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 154791421 |
| Molecular Formula | C11H10ClF6N |
| Molecular Weight | 305.65 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[2,6-bis(trifluoromethyl)phenyl]azetidine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(C(F)(F)F)c1C1CNC1 |
| InChI | InChI=1S/C11H9F6N.ClH/c12-10(13,14)7-2-1-3-8(11(15,16)17)9(7)6-4-18-5-6;/h1-3,6,18H,4-5H2;1H |
| InChIKey | NJPMIQVXYNUVST-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |