About 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride
4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 67486328) has the molecular formula C9H9ClF3N
and a molecular weight of 223.62 g/mol. Its IUPAC name is 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride |
| PubChem CID | 67486328 |
| Molecular Formula | C9H9ClF3N |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc2c1CNC2 |
| InChI | InChI=1S/C9H8F3N.ClH/c10-9(11,12)8-3-1-2-6-4-13-5-7(6)8;/h1-3,13H,4-5H2;1H |
| InChIKey | XTPDOTXDUZRPAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride?
The IUPAC name of 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride (CID 67486328) is 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride.
What is the SMILES notation for 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride?
The canonical SMILES for 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride is Cl.FC(F)(F)c1cccc2c1CNC2.
What is the InChIKey of 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride?
The InChIKey is XTPDOTXDUZRPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3N.ClH/c10-9(11,12)8-3-1-2-6-4-13-5-7(6)8;/h1-3,13H,4-5H2;1H.
What are the key properties of 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride?
4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride has a molecular weight of 223.62 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride is sourced from PubChem (CID 67486328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).