C15H24O3 — CID 15479313
ethyl 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 15479313) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | ethyl 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 15479313 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | C=C[C@]12CC[C@H](C[C@]1(O)CC(=O)OCC)C2(C)C |
| InChI | InChI=1S/C15H24O3/c1-5-14-8-7-11(13(14,3)4)9-15(14,17)10-12(16)18-6-2/h5,11,17H,1,6-10H2,2-4H3/t11-,14-,15+/m1/s1 |
| InChIKey | DRQWWQZYHXNWLV-DFBGVHRSSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|