C14H13N3O2 — CID 154793562
2-(ethoxymethyl)-5-isoquinolin-1-yl-1,3,4-oxadiazole (PubChem CID 154793562) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(ethoxymethyl)-5-isoquinolin-1-yl-1,3,4-oxadiazole.
| Compound Name | 2-(ethoxymethyl)-5-isoquinolin-1-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 154793562 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(ethoxymethyl)-5-isoquinolin-1-yl-1,3,4-oxadiazole |
| SMILES | CCOCc1nnc(-c2nccc3ccccc23)o1 |
| InChI | InChI=1S/C14H13N3O2/c1-2-18-9-12-16-17-14(19-12)13-11-6-4-3-5-10(11)7-8-15-13/h3-8H,2,9H2,1H3 |
| InChIKey | UNWYVZYGUMLDNF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |