C20H14N2O3 — CID 27919131
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]naphthalene-1-carbaldehyde (PubChem CID 27919131) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]naphthalene-1-carbaldehyde.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 27919131 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]naphthalene-1-carbaldehyde |
| SMILES | O=Cc1c(OCc2nnc(-c3ccccc3)o2)ccc2ccccc12 |
| InChI | InChI=1S/C20H14N2O3/c23-12-17-16-9-5-4-6-14(16)10-11-18(17)24-13-19-21-22-20(25-19)15-7-2-1-3-8-15/h1-12H,13H2 |
| InChIKey | WYNFWYGKTKOIHO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|