C15H10BrNO3 — CID 86041011
2-[(3-bromo-1,2-oxazol-5-yl)methoxy]naphthalene-1-carbaldehyde (PubChem CID 86041011) has the molecular formula C15H10BrNO3 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-[(3-bromo-1,2-oxazol-5-yl)methoxy]naphthalene-1-carbaldehyde.
| Compound Name | 2-[(3-bromo-1,2-oxazol-5-yl)methoxy]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 86041011 |
| Molecular Formula | C15H10BrNO3 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-[(3-bromo-1,2-oxazol-5-yl)methoxy]naphthalene-1-carbaldehyde |
| SMILES | O=Cc1c(OCc2cc(Br)no2)ccc2ccccc12 |
| InChI | InChI=1S/C15H10BrNO3/c16-15-7-11(20-17-15)9-19-14-6-5-10-3-1-2-4-12(10)13(14)8-18/h1-8H,9H2 |
| InChIKey | BVANYOXHNMTYCB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|