C12H16BrNO2S — CID 154795317
4-bromo-N-[3-(cyclopropylmethoxy)propyl]thiophene-2-carboxamide (PubChem CID 154795317) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-bromo-N-[3-(cyclopropylmethoxy)propyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[3-(cyclopropylmethoxy)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 154795317 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-bromo-N-[3-(cyclopropylmethoxy)propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCOCC1CC1)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H16BrNO2S/c13-10-6-11(17-8-10)12(15)14-4-1-5-16-7-9-2-3-9/h6,8-9H,1-5,7H2,(H,14,15) |
| InChIKey | AFIMBBCAEFBVES-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|