C16H21BrN2O3 — CID 18120944
3-bromo-N-[2-[3-(cyclopropylmethoxy)propylamino]-2-oxoethyl]benzamide (PubChem CID 18120944) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is 3-bromo-N-[2-[3-(cyclopropylmethoxy)propylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[3-(cyclopropylmethoxy)propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 18120944 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-bromo-N-[2-[3-(cyclopropylmethoxy)propylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCCCOCC1CC1 |
| InChI | InChI=1S/C16H21BrN2O3/c17-14-4-1-3-13(9-14)16(21)19-10-15(20)18-7-2-8-22-11-12-5-6-12/h1,3-4,9,12H,2,5-8,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | NCNYBSRRVTZTCN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|