C13H12ClF2N3O2S — CID 154796033
N-(2-chloro-4,5-difluorophenyl)-1-cyclobutylpyrazole-4-sulfonamide (PubChem CID 154796033) has the molecular formula C13H12ClF2N3O2S and a molecular weight of 347.77 g/mol. Its IUPAC name is N-(2-chloro-4,5-difluorophenyl)-1-cyclobutylpyrazole-4-sulfonamide.
| Compound Name | N-(2-chloro-4,5-difluorophenyl)-1-cyclobutylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 154796033 |
| Molecular Formula | C13H12ClF2N3O2S |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(2-chloro-4,5-difluorophenyl)-1-cyclobutylpyrazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)cc1Cl)c1cnn(C2CCC2)c1 |
| InChI | InChI=1S/C13H12ClF2N3O2S/c14-10-4-11(15)12(16)5-13(10)18-22(20,21)9-6-17-19(7-9)8-2-1-3-8/h4-8,18H,1-3H2 |
| InChIKey | YONRPIXZZFFBJE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|