About methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate
methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate (PubChem CID 154796416) has the molecular formula C14H17N3O4S
and a molecular weight of 323.37 g/mol. Its IUPAC name is methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate |
| PubChem CID | 154796416 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)N=S(C)(C)=O)c2ccccc2n1C |
| InChI | InChI=1S/C14H17N3O4S/c1-17-10-8-6-5-7-9(10)11(12(17)13(18)21-2)15-14(19)16-22(3,4)20/h5-8H,1-4H3,(H,15,19) |
| InChIKey | BSZYRNXNFKMYLO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate?
The IUPAC name of methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate (CID 154796416) is methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate.
What is the SMILES notation for methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate?
The canonical SMILES for methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate is COC(=O)c1c(NC(=O)N=S(C)(C)=O)c2ccccc2n1C.
What is the InChIKey of methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate?
The InChIKey is BSZYRNXNFKMYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4S/c1-17-10-8-6-5-7-9(10)11(12(17)13(18)21-2)15-14(19)16-22(3,4)20/h5-8H,1-4H3,(H,15,19).
What are the key properties of methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate?
methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate has a molecular weight of 323.37 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[dimethyl(oxo)-λ6-sulfanylidene]carbamoylamino]-1-methylindole-2-carboxylate is sourced from PubChem (CID 154796416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).