C19H20N6O3 — CID 154796474
N-[2-methoxy-4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]acetamide (PubChem CID 154796474) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[2-methoxy-4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-methoxy-4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 154796474 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[2-methoxy-4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]acetamide |
| SMILES | COc1cc(NC(=O)NCc2cccnc2-n2cccn2)ccc1NC(C)=O |
| InChI | InChI=1S/C19H20N6O3/c1-13(26)23-16-7-6-15(11-17(16)28-2)24-19(27)21-12-14-5-3-8-20-18(14)25-10-4-9-22-25/h3-11H,12H2,1-2H3,(H,23,26)(H2,21,24,27) |
| InChIKey | DZNQBOJJQWAONW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |