C18H18N6O3 — CID 55799910
methyl N-[4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]carbamate (PubChem CID 55799910) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl N-[4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]carbamate.
| Compound Name | methyl N-[4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 55799910 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl N-[4-[(2-pyrazol-1-yl-3-pyridinyl)methylcarbamoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)NCc2cccnc2-n2cccn2)cc1 |
| InChI | InChI=1S/C18H18N6O3/c1-27-18(26)23-15-7-5-14(6-8-15)22-17(25)20-12-13-4-2-9-19-16(13)24-11-3-10-21-24/h2-11H,12H2,1H3,(H,23,26)(H2,20,22,25) |
| InChIKey | WGSJILQVNBRTGT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |