C18H17N3O2S — CID 154796771
7-methyl-1-(1-phenylpyrazol-4-yl)sulfonyl-2,3-dihydroindole (PubChem CID 154796771) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 7-methyl-1-(1-phenylpyrazol-4-yl)sulfonyl-2,3-dihydroindole.
| Compound Name | 7-methyl-1-(1-phenylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 154796771 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 7-methyl-1-(1-phenylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
| SMILES | Cc1cccc2c1N(S(=O)(=O)c1cnn(-c3ccccc3)c1)CC2 |
| InChI | InChI=1S/C18H17N3O2S/c1-14-6-5-7-15-10-11-21(18(14)15)24(22,23)17-12-19-20(13-17)16-8-3-2-4-9-16/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | RLBRSMSQFACFKL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |