C13H15N3O3S — CID 63215072
1-(1-methylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-8-ol (PubChem CID 63215072) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-8-ol.
| Compound Name | 1-(1-methylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-8-ol |
|---|---|
| PubChem CID | 63215072 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-8-ol |
| SMILES | Cn1cc(S(=O)(=O)N2CCCc3cccc(O)c32)cn1 |
| InChI | InChI=1S/C13H15N3O3S/c1-15-9-11(8-14-15)20(18,19)16-7-3-5-10-4-2-6-12(17)13(10)16/h2,4,6,8-9,17H,3,5,7H2,1H3 |
| InChIKey | OCUUSBJLOFLJRJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |