C11H19F3N2O4 — CID 154798319
2-[[(4R)-4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-yl]-methylamino]acetic acid (PubChem CID 154798319) has the molecular formula C11H19F3N2O4 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[[(4R)-4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(4R)-4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 154798319 |
| Molecular Formula | C11H19F3N2O4 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[[(4R)-4-hydroxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-3-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C1CN(CCOCC(F)(F)F)C[C@H]1O |
| InChI | InChI=1S/C11H19F3N2O4/c1-15(6-10(18)19)8-4-16(5-9(8)17)2-3-20-7-11(12,13)14/h8-9,17H,2-7H2,1H3,(H,18,19)/t8?,9-/m1/s1 |
| InChIKey | CHYZILPDIWAHFO-YGPZHTELSA-N |
| XLogP | -0.37 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|