C17H18N6O2 — CID 154799535
2-[[1-(tetrazolo[1,5-a]pyrazin-8-yl)piperidin-4-yl]methyl]benzoic acid (PubChem CID 154799535) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[[1-(tetrazolo[1,5-a]pyrazin-8-yl)piperidin-4-yl]methyl]benzoic acid.
| Compound Name | 2-[[1-(tetrazolo[1,5-a]pyrazin-8-yl)piperidin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 154799535 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[[1-(tetrazolo[1,5-a]pyrazin-8-yl)piperidin-4-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CC1CCN(c2nccn3nnnc23)CC1 |
| InChI | InChI=1S/C17H18N6O2/c24-17(25)14-4-2-1-3-13(14)11-12-5-8-22(9-6-12)15-16-19-20-21-23(16)10-7-18-15/h1-4,7,10,12H,5-6,8-9,11H2,(H,24,25) |
| InChIKey | FCMWPODSHRCHRM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |