C20H20N6 — CID 3241422
4-(4-benzylpiperidin-1-yl)tetrazolo[1,5-a]quinoxaline (PubChem CID 3241422) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)tetrazolo[1,5-a]quinoxaline.
| Compound Name | 4-(4-benzylpiperidin-1-yl)tetrazolo[1,5-a]quinoxaline |
|---|---|
| PubChem CID | 3241422 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)tetrazolo[1,5-a]quinoxaline |
| SMILES | c1ccc(CC2CCN(c3nc4ccccc4n4nnnc34)CC2)cc1 |
| InChI | InChI=1S/C20H20N6/c1-2-6-15(7-3-1)14-16-10-12-25(13-11-16)19-20-22-23-24-26(20)18-9-5-4-8-17(18)21-19/h1-9,16H,10-14H2 |
| InChIKey | YHCDGPQQTWQZCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |