C14H21NO3S — CID 154802130
3-[[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]amino]propanoic acid (PubChem CID 154802130) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-[[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]amino]propanoic acid.
| Compound Name | 3-[[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 154802130 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-[[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]amino]propanoic acid |
| SMILES | COc1ccccc1SCC(C)CNCCC(=O)O |
| InChI | InChI=1S/C14H21NO3S/c1-11(9-15-8-7-14(16)17)10-19-13-6-4-3-5-12(13)18-2/h3-6,11,15H,7-10H2,1-2H3,(H,16,17) |
| InChIKey | NPINIPSLONOKMO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|