C13H18Cl2O2 — CID 15480479
2,3-dichloro-4-hydroxy-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one (PubChem CID 15480479) has the molecular formula C13H18Cl2O2 and a molecular weight of 277.19 g/mol. Its IUPAC name is 2,3-dichloro-4-hydroxy-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 2,3-dichloro-4-hydroxy-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 15480479 |
| Molecular Formula | C13H18Cl2O2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2,3-dichloro-4-hydroxy-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C\CC1(O)CC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C13H18Cl2O2/c1-2-3-4-5-6-7-8-13(17)9-10(16)11(14)12(13)15/h6-7,17H,2-5,8-9H2,1H3/b7-6- |
| InChIKey | UZCQGALWIJJSPB-SREVYHEPSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|