C8H8Cl2O2 — CID 15939109
(4S)-2,3-dichloro-4-hydroxy-4-prop-2-enylcyclopent-2-en-1-one (PubChem CID 15939109) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is (4S)-2,3-dichloro-4-hydroxy-4-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (4S)-2,3-dichloro-4-hydroxy-4-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 15939109 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (4S)-2,3-dichloro-4-hydroxy-4-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@]1(O)CC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H8Cl2O2/c1-2-3-8(12)4-5(11)6(9)7(8)10/h2,12H,1,3-4H2/t8-/m0/s1 |
| InChIKey | VTKYNJQROIVSPT-QMMMGPOBSA-N |
| XLogP | 1.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|