C10H14N2O2 — CID 15480603
(8S,8aR)-8-(hydroxymethyl)-3-oxo-1,2,5,6,7,8-hexahydroindolizine-8a-carbonitrile (PubChem CID 15480603) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (8S,8aR)-8-(hydroxymethyl)-3-oxo-1,2,5,6,7,8-hexahydroindolizine-8a-carbonitrile.
| Compound Name | (8S,8aR)-8-(hydroxymethyl)-3-oxo-1,2,5,6,7,8-hexahydroindolizine-8a-carbonitrile |
|---|---|
| PubChem CID | 15480603 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (8S,8aR)-8-(hydroxymethyl)-3-oxo-1,2,5,6,7,8-hexahydroindolizine-8a-carbonitrile |
| SMILES | N#C[C@]12CCC(=O)N1CCC[C@@H]2CO |
| InChI | InChI=1S/C10H14N2O2/c11-7-10-4-3-9(14)12(10)5-1-2-8(10)6-13/h8,13H,1-6H2/t8-,10+/m1/s1 |
| InChIKey | ZHTAQEGEXLFBIW-SCZZXKLOSA-N |
| XLogP | 0.27 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |