C17H15IN4O2 — CID 154806253
N-(2-iodo-5-methoxyphenyl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 154806253) has the molecular formula C17H15IN4O2 and a molecular weight of 434.24 g/mol. Its IUPAC name is N-(2-iodo-5-methoxyphenyl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(2-iodo-5-methoxyphenyl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154806253 |
| Molecular Formula | C17H15IN4O2 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-(2-iodo-5-methoxyphenyl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | COc1ccc(I)c(NC(=O)c2cnn(-c3ccccn3)c2C)c1 |
| InChI | InChI=1S/C17H15IN4O2/c1-11-13(10-20-22(11)16-5-3-4-8-19-16)17(23)21-15-9-12(24-2)6-7-14(15)18/h3-10H,1-2H3,(H,21,23) |
| InChIKey | UQMRJSPNFFDMSQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|