C18H20N2O5S — CID 154807422
(3aR,7aR)-2-(6-methylquinolin-8-yl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154807422) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is (3aR,7aR)-2-(6-methylquinolin-8-yl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-(6-methylquinolin-8-yl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154807422 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (3aR,7aR)-2-(6-methylquinolin-8-yl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@@H]3CCOC[C@]3(C(=O)O)C2)c2ncccc2c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12-7-13-3-2-5-19-16(13)15(8-12)26(23,24)20-9-14-4-6-25-11-18(14,10-20)17(21)22/h2-3,5,7-8,14H,4,6,9-11H2,1H3,(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | KCYFYAPORQKFEW-KBXCAEBGSA-N |
| XLogP | 1.66 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |