C12H15NO5S2 — CID 166273591
(3aS,7aS)-2-thiophen-3-ylsulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 166273591) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3aS,7aS)-2-thiophen-3-ylsulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-thiophen-3-ylsulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 166273591 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (3aS,7aS)-2-thiophen-3-ylsulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12COCC[C@@H]1CN(S(=O)(=O)c1ccsc1)C2 |
| InChI | InChI=1S/C12H15NO5S2/c14-11(15)12-7-13(5-9(12)1-3-18-8-12)20(16,17)10-2-4-19-6-10/h2,4,6,9H,1,3,5,7-8H2,(H,14,15)/t9-,12+/m1/s1 |
| InChIKey | HXQYQPPXRMUTAS-SKDRFNHKSA-N |
| XLogP | 0.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |