C10H9ClF2N2O — CID 154807613
N-[1-(3-chlorophenyl)ethylideneamino]-2,2-difluoroacetamide (PubChem CID 154807613) has the molecular formula C10H9ClF2N2O and a molecular weight of 246.64 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethylideneamino]-2,2-difluoroacetamide.
| Compound Name | N-[1-(3-chlorophenyl)ethylideneamino]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 154807613 |
| Molecular Formula | C10H9ClF2N2O |
| Molecular Weight | 246.64 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethylideneamino]-2,2-difluoroacetamide |
| SMILES | CC(=NNC(=O)C(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H9ClF2N2O/c1-6(14-15-10(16)9(12)13)7-3-2-4-8(11)5-7/h2-5,9H,1H3,(H,15,16) |
| InChIKey | DWMYJVAVYULGKX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|