C16H16ClN3O3S — CID 9236360
2-(benzenesulfonamido)-N-[(Z)-1-(3-chlorophenyl)ethylideneamino]acetamide (PubChem CID 9236360) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-1-(3-chlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-1-(3-chlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9236360 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-1-(3-chlorophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CNS(=O)(=O)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-12(13-6-5-7-14(17)10-13)19-20-16(21)11-18-24(22,23)15-8-3-2-4-9-15/h2-10,18H,11H2,1H3,(H,20,21)/b19-12- |
| InChIKey | RJQSIEHSAHZISS-UNOMPAQXSA-N |
| XLogP | 2.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|