C14H21N3O3S — CID 9236234
2-(benzenesulfonamido)-N-[(Z)-2-methylpentan-3-ylideneamino]acetamide (PubChem CID 9236234) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-2-methylpentan-3-ylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-2-methylpentan-3-ylideneamino]acetamide |
|---|---|
| PubChem CID | 9236234 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-2-methylpentan-3-ylideneamino]acetamide |
| SMILES | CC/C(=N/NC(=O)CNS(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C14H21N3O3S/c1-4-13(11(2)3)16-17-14(18)10-15-21(19,20)12-8-6-5-7-9-12/h5-9,11,15H,4,10H2,1-3H3,(H,17,18)/b16-13- |
| InChIKey | NMXXEZBOXFNJJH-SSZFMOIBSA-N |
| XLogP | 1.50 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|